About 2-[3-[3-[3-(carboxymethylsulfanyl)propylsulfanyl]propylsulfanyl]propylsulfanyl]acetic acid;rhodium-105(3+)
2-[3-[3-[3-(carboxymethylsulfanyl)propylsulfanyl]propylsulfanyl]propylsulfanyl]acetic acid;rhodium-105(3+) (PubChem CID 10457749) has the molecular formula C13H24O4RhS4+3
and a molecular weight of 477.50 g/mol. Its IUPAC name is 2-[3-[3-[3-(carboxymethylsulfanyl)propylsulfanyl]propylsulfanyl]propylsulfanyl]acetic acid;rhodium-105(3+).
Molecular Properties
| Compound Name | 2-[3-[3-[3-(carboxymethylsulfanyl)propylsulfanyl]propylsulfanyl]propylsulfanyl]acetic acid;rhodium-105(3+) |
| PubChem CID | 10457749 |
| Molecular Formula | C13H24O4RhS4+3 |
| Molecular Weight | 477.50 g/mol |
| Exact Mass | 476.96 |
| IUPAC Name | 2-[3-[3-[3-(carboxymethylsulfanyl)propylsulfanyl]propylsulfanyl]propylsulfanyl]acetic acid;rhodium-105(3+) |
| SMILES | O=C(O)CSCCCSCCCSCCCSCC(=O)O.[105Rh+3] |
| InChI | InChI=1S/C13H24O4S4.Rh/c14-12(15)10-20-8-2-6-18-4-1-5-19-7-3-9-21-11-13(16)17;/h1-11H2,(H,14,15)(H,16,17);/q;+3/i;1+2 |
| InChIKey | WZJONYLZILBLBC-NLQOEHMXSA-N |
| XLogP | 3.26 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 477.50 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-[3-[3-(carboxymethylsulfanyl)propylsulfanyl]propylsulfanyl]propylsulfanyl]acetic acid;rhodium-105(3+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-[3-[3-(carboxymethylsulfanyl)propylsulfanyl]propylsulfanyl]propylsulfanyl]acetic acid;rhodium-105(3+)?
The IUPAC name of 2-[3-[3-[3-(carboxymethylsulfanyl)propylsulfanyl]propylsulfanyl]propylsulfanyl]acetic acid;rhodium-105(3+) (CID 10457749) is 2-[3-[3-[3-(carboxymethylsulfanyl)propylsulfanyl]propylsulfanyl]propylsulfanyl]acetic acid;rhodium-105(3+).
What is the SMILES notation for 2-[3-[3-[3-(carboxymethylsulfanyl)propylsulfanyl]propylsulfanyl]propylsulfanyl]acetic acid;rhodium-105(3+)?
The canonical SMILES for 2-[3-[3-[3-(carboxymethylsulfanyl)propylsulfanyl]propylsulfanyl]propylsulfanyl]acetic acid;rhodium-105(3+) is O=C(O)CSCCCSCCCSCCCSCC(=O)O.[105Rh+3].
What is the InChIKey of 2-[3-[3-[3-(carboxymethylsulfanyl)propylsulfanyl]propylsulfanyl]propylsulfanyl]acetic acid;rhodium-105(3+)?
The InChIKey is WZJONYLZILBLBC-NLQOEHMXSA-N. The full InChI is InChI=1S/C13H24O4S4.Rh/c14-12(15)10-20-8-2-6-18-4-1-5-19-7-3-9-21-11-13(16)17;/h1-11H2,(H,14,15)(H,16,17);/q;+3/i;1+2.
What are the key properties of 2-[3-[3-[3-(carboxymethylsulfanyl)propylsulfanyl]propylsulfanyl]propylsulfanyl]acetic acid;rhodium-105(3+)?
2-[3-[3-[3-(carboxymethylsulfanyl)propylsulfanyl]propylsulfanyl]propylsulfanyl]acetic acid;rhodium-105(3+) has a molecular weight of 477.50 g/mol, XLogP of 3.26, 16 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[3-[3-(carboxymethylsulfanyl)propylsulfanyl]propylsulfanyl]propylsulfanyl]acetic acid;rhodium-105(3+) is sourced from PubChem (CID 10457749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).