C12H22O5S2 — CID 155771069
2-[4-[4-(carboxymethylsulfanyl)butoxy]butylsulfanyl]acetic acid (PubChem CID 155771069) has the molecular formula C12H22O5S2 and a molecular weight of 310.44 g/mol. Its IUPAC name is 2-[4-[4-(carboxymethylsulfanyl)butoxy]butylsulfanyl]acetic acid.
| Compound Name | 2-[4-[4-(carboxymethylsulfanyl)butoxy]butylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 155771069 |
| Molecular Formula | C12H22O5S2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 2-[4-[4-(carboxymethylsulfanyl)butoxy]butylsulfanyl]acetic acid |
| SMILES | O=C(O)CSCCCCOCCCCSCC(=O)O |
| InChI | InChI=1S/C12H22O5S2/c13-11(14)9-18-7-3-1-5-17-6-2-4-8-19-10-12(15)16/h1-10H2,(H,13,14)(H,15,16) |
| InChIKey | DWEIELRLCFOYRZ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|