C19H26NNaO4S — CID 173167574
sodium;hydride;2-[5-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]pentylsulfanyl]acetic acid (PubChem CID 173167574) has the molecular formula C19H26NNaO4S and a molecular weight of 387.48 g/mol. Its IUPAC name is sodium;hydride;2-[5-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]pentylsulfanyl]acetic acid.
| Compound Name | sodium;hydride;2-[5-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]pentylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 173167574 |
| Molecular Formula | C19H26NNaO4S |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | sodium;hydride;2-[5-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]pentylsulfanyl]acetic acid |
| SMILES | Cc1oc(-c2ccccc2)nc1CCOCCCCCSCC(=O)O.[H-].[Na+] |
| InChI | InChI=1S/C19H25NO4S.Na.H/c1-15-17(20-19(24-15)16-8-4-2-5-9-16)10-12-23-11-6-3-7-13-25-14-18(21)22;;/h2,4-5,8-9H,3,6-7,10-14H2,1H3,(H,21,22);;/q;+1;-1 |
| InChIKey | CPJVIKYGTVKKEX-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|