C20H19NO2S — CID 19013418
4-[3-(5-methyl-2-phenyl-1,3-oxazol-4-yl)propylsulfanyl]benzaldehyde (PubChem CID 19013418) has the molecular formula C20H19NO2S and a molecular weight of 337.44 g/mol. Its IUPAC name is 4-[3-(5-methyl-2-phenyl-1,3-oxazol-4-yl)propylsulfanyl]benzaldehyde.
| Compound Name | 4-[3-(5-methyl-2-phenyl-1,3-oxazol-4-yl)propylsulfanyl]benzaldehyde |
|---|---|
| PubChem CID | 19013418 |
| Molecular Formula | C20H19NO2S |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | 4-[3-(5-methyl-2-phenyl-1,3-oxazol-4-yl)propylsulfanyl]benzaldehyde |
| SMILES | Cc1oc(-c2ccccc2)nc1CCCSc1ccc(C=O)cc1 |
| InChI | InChI=1S/C20H19NO2S/c1-15-19(21-20(23-15)17-6-3-2-4-7-17)8-5-13-24-18-11-9-16(14-22)10-12-18/h2-4,6-7,9-12,14H,5,8,13H2,1H3 |
| InChIKey | YZAUWVJFRMNJCY-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|