C12H11NO2 — CID 18984662
2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)acetaldehyde (PubChem CID 18984662) has the molecular formula C12H11NO2 and a molecular weight of 201.23 g/mol. Its IUPAC name is 2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)acetaldehyde.
| Compound Name | 2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)acetaldehyde |
|---|---|
| PubChem CID | 18984662 |
| Molecular Formula | C12H11NO2 |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | 2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)acetaldehyde |
| SMILES | Cc1oc(-c2ccccc2)nc1CC=O |
| InChI | InChI=1S/C12H11NO2/c1-9-11(7-8-14)13-12(15-9)10-5-3-2-4-6-10/h2-6,8H,7H2,1H3 |
| InChIKey | OILCAWGLITYJMZ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|