C11H12N2O — CID 15616431
(5-methyl-2-phenyl-1,3-oxazol-4-yl)methanamine (PubChem CID 15616431) has the molecular formula C11H12N2O and a molecular weight of 188.23 g/mol. Its IUPAC name is (5-methyl-2-phenyl-1,3-oxazol-4-yl)methanamine.
| Compound Name | (5-methyl-2-phenyl-1,3-oxazol-4-yl)methanamine |
|---|---|
| PubChem CID | 15616431 |
| Molecular Formula | C11H12N2O |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | (5-methyl-2-phenyl-1,3-oxazol-4-yl)methanamine |
| SMILES | Cc1oc(-c2ccccc2)nc1CN |
| InChI | InChI=1S/C11H12N2O/c1-8-10(7-12)13-11(14-8)9-5-3-2-4-6-9/h2-6H,7,12H2,1H3 |
| InChIKey | LEKZZMAVLLJSNA-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |