C30H27NOP+ — CID 24742720
[5-methyl-2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl-triphenylphosphanium (PubChem CID 24742720) has the molecular formula C30H27NOP+ and a molecular weight of 448.53 g/mol. Its IUPAC name is [5-methyl-2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl-triphenylphosphanium.
| Compound Name | [5-methyl-2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl-triphenylphosphanium |
|---|---|
| PubChem CID | 24742720 |
| Molecular Formula | C30H27NOP+ |
| Molecular Weight | 448.53 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | [5-methyl-2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl-triphenylphosphanium |
| SMILES | Cc1ccc(-c2nc(C[P+](c3ccccc3)(c3ccccc3)c3ccccc3)c(C)o2)cc1 |
| InChI | InChI=1S/C30H27NOP/c1-23-18-20-25(21-19-23)30-31-29(24(2)32-30)22-33(26-12-6-3-7-13-26,27-14-8-4-9-15-27)28-16-10-5-11-17-28/h3-21H,22H2,1-2H3/q+1 |
| InChIKey | YXKCAONBQCJDPZ-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.53 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|