C30H27ClNOP — CID 140519078
chloro-[[5-methyl-2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]-triphenyl-λ5-phosphane (PubChem CID 140519078) has the molecular formula C30H27ClNOP and a molecular weight of 483.98 g/mol. Its IUPAC name is chloro-[[5-methyl-2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]-triphenyl-λ5-phosphane.
| Compound Name | chloro-[[5-methyl-2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]-triphenyl-λ5-phosphane |
|---|---|
| PubChem CID | 140519078 |
| Molecular Formula | C30H27ClNOP |
| Molecular Weight | 483.98 g/mol |
| Exact Mass | 483.15 |
| IUPAC Name | chloro-[[5-methyl-2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]-triphenyl-λ5-phosphane |
| SMILES | Cc1ccc(-c2nc(CP(Cl)(c3ccccc3)(c3ccccc3)c3ccccc3)c(C)o2)cc1 |
| InChI | InChI=1S/C30H27ClNOP/c1-23-18-20-25(21-19-23)30-32-29(24(2)33-30)22-34(31,26-12-6-3-7-13-26,27-14-8-4-9-15-27)28-16-10-5-11-17-28/h3-21H,22H2,1-2H3 |
| InChIKey | UDGWIUMZBSNQCL-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.98 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|