C21H19NO3 — CID 16588525
(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl (E)-3-(4-methylphenyl)prop-2-enoate (PubChem CID 16588525) has the molecular formula C21H19NO3 and a molecular weight of 333.39 g/mol. Its IUPAC name is (5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl (E)-3-(4-methylphenyl)prop-2-enoate.
| Compound Name | (5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl (E)-3-(4-methylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 16588525 |
| Molecular Formula | C21H19NO3 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | (5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl (E)-3-(4-methylphenyl)prop-2-enoate |
| SMILES | Cc1ccc(/C=C/C(=O)OCc2nc(-c3ccccc3)oc2C)cc1 |
| InChI | InChI=1S/C21H19NO3/c1-15-8-10-17(11-9-15)12-13-20(23)24-14-19-16(2)25-21(22-19)18-6-4-3-5-7-18/h3-13H,14H2,1-2H3/b13-12+ |
| InChIKey | HCAYKIXIIYRSQJ-OUKQBFOZSA-N |
| XLogP | 4.72 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|