C16H20N2O3 — CID 174457972
(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl N-tert-butylcarbamate (PubChem CID 174457972) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is (5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl N-tert-butylcarbamate.
| Compound Name | (5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl N-tert-butylcarbamate |
|---|---|
| PubChem CID | 174457972 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | (5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl N-tert-butylcarbamate |
| SMILES | Cc1oc(-c2ccccc2)nc1COC(=O)NC(C)(C)C |
| InChI | InChI=1S/C16H20N2O3/c1-11-13(10-20-15(19)18-16(2,3)4)17-14(21-11)12-8-6-5-7-9-12/h5-9H,10H2,1-4H3,(H,18,19) |
| InChIKey | JXAXSGFHHRIYTK-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |