C18H14FNO3 — CID 16588712
(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl 2-fluorobenzoate (PubChem CID 16588712) has the molecular formula C18H14FNO3 and a molecular weight of 311.31 g/mol. Its IUPAC name is (5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl 2-fluorobenzoate.
| Compound Name | (5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl 2-fluorobenzoate |
|---|---|
| PubChem CID | 16588712 |
| Molecular Formula | C18H14FNO3 |
| Molecular Weight | 311.31 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | (5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl 2-fluorobenzoate |
| SMILES | Cc1oc(-c2ccccc2)nc1COC(=O)c1ccccc1F |
| InChI | InChI=1S/C18H14FNO3/c1-12-16(20-17(23-12)13-7-3-2-4-8-13)11-22-18(21)14-9-5-6-10-15(14)19/h2-10H,11H2,1H3 |
| InChIKey | JZIATEVZLWJRBM-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.31 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |