C19H17NO3 — CID 16588766
(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl 2-methylbenzoate (PubChem CID 16588766) has the molecular formula C19H17NO3 and a molecular weight of 307.35 g/mol. Its IUPAC name is (5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl 2-methylbenzoate.
| Compound Name | (5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl 2-methylbenzoate |
|---|---|
| PubChem CID | 16588766 |
| Molecular Formula | C19H17NO3 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | (5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl 2-methylbenzoate |
| SMILES | Cc1ccccc1C(=O)OCc1nc(-c2ccccc2)oc1C |
| InChI | InChI=1S/C19H17NO3/c1-13-8-6-7-11-16(13)19(21)22-12-17-14(2)23-18(20-17)15-9-4-3-5-10-15/h3-11H,12H2,1-2H3 |
| InChIKey | CPQRZNYSJGDFTE-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |