C24H25NO4 — CID 86751224
ethyl (E)-3-[4-[2-[5-methyl-2-(3-methylphenyl)-1,3-oxazol-4-yl]ethoxy]phenyl]prop-2-enoate (PubChem CID 86751224) has the molecular formula C24H25NO4 and a molecular weight of 391.47 g/mol. Its IUPAC name is ethyl (E)-3-[4-[2-[5-methyl-2-(3-methylphenyl)-1,3-oxazol-4-yl]ethoxy]phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[4-[2-[5-methyl-2-(3-methylphenyl)-1,3-oxazol-4-yl]ethoxy]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 86751224 |
| Molecular Formula | C24H25NO4 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | ethyl (E)-3-[4-[2-[5-methyl-2-(3-methylphenyl)-1,3-oxazol-4-yl]ethoxy]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1ccc(OCCc2nc(-c3cccc(C)c3)oc2C)cc1 |
| InChI | InChI=1S/C24H25NO4/c1-4-27-23(26)13-10-19-8-11-21(12-9-19)28-15-14-22-18(3)29-24(25-22)20-7-5-6-17(2)16-20/h5-13,16H,4,14-15H2,1-3H3/b13-10+ |
| InChIKey | UNYRZDMRUCSOCS-JLHYYAGUSA-N |
| XLogP | 5.16 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|