C22H21NO4S — CID 15230617
(Z)-3-[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]-2-methylsulfanylprop-2-enoic acid (PubChem CID 15230617) has the molecular formula C22H21NO4S and a molecular weight of 395.48 g/mol. Its IUPAC name is (Z)-3-[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]-2-methylsulfanylprop-2-enoic acid.
| Compound Name | (Z)-3-[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]-2-methylsulfanylprop-2-enoic acid |
|---|---|
| PubChem CID | 15230617 |
| Molecular Formula | C22H21NO4S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | (Z)-3-[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]-2-methylsulfanylprop-2-enoic acid |
| SMILES | CS/C(=C\c1ccc(OCCc2nc(-c3ccccc3)oc2C)cc1)C(=O)O |
| InChI | InChI=1S/C22H21NO4S/c1-15-19(23-21(27-15)17-6-4-3-5-7-17)12-13-26-18-10-8-16(9-11-18)14-20(28-2)22(24)25/h3-11,14H,12-13H2,1-2H3,(H,24,25)/b20-14- |
| InChIKey | RITHGVWETJCXKX-ZHZULCJRSA-N |
| XLogP | 5.06 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|