C24H26N2O4S — CID 143214888
S-[(Z)-3-amino-1-[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]-3-oxoprop-1-en-2-yl] methanethioate;ethane (PubChem CID 143214888) has the molecular formula C24H26N2O4S and a molecular weight of 438.55 g/mol. Its IUPAC name is S-[(Z)-3-amino-1-[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]-3-oxoprop-1-en-2-yl] methanethioate;ethane.
| Compound Name | S-[(Z)-3-amino-1-[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]-3-oxoprop-1-en-2-yl] methanethioate;ethane |
|---|---|
| PubChem CID | 143214888 |
| Molecular Formula | C24H26N2O4S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | S-[(Z)-3-amino-1-[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]-3-oxoprop-1-en-2-yl] methanethioate;ethane |
| SMILES | CC.Cc1oc(-c2ccccc2)nc1CCOc1ccc(/C=C(\SC=O)C(N)=O)cc1 |
| InChI | InChI=1S/C22H20N2O4S.C2H6/c1-15-19(24-22(28-15)17-5-3-2-4-6-17)11-12-27-18-9-7-16(8-10-18)13-20(21(23)26)29-14-25;1-2/h2-10,13-14H,11-12H2,1H3,(H2,23,26);1-2H3/b20-13-; |
| InChIKey | FQNAPBRRJUSAHR-MASIZSFYSA-N |
| XLogP | 5.05 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|