C24H26N2O5 — CID 139706656
ethyl 2-formamido-3-[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]propanoate (PubChem CID 139706656) has the molecular formula C24H26N2O5 and a molecular weight of 422.48 g/mol. Its IUPAC name is ethyl 2-formamido-3-[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]propanoate.
| Compound Name | ethyl 2-formamido-3-[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 139706656 |
| Molecular Formula | C24H26N2O5 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | ethyl 2-formamido-3-[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]propanoate |
| SMILES | CCOC(=O)C(Cc1ccc(OCCc2nc(-c3ccccc3)oc2C)cc1)NC=O |
| InChI | InChI=1S/C24H26N2O5/c1-3-29-24(28)22(25-16-27)15-18-9-11-20(12-10-18)30-14-13-21-17(2)31-23(26-21)19-7-5-4-6-8-19/h4-12,16,22H,3,13-15H2,1-2H3,(H,25,27) |
| InChIKey | PECWWKZQOJYICF-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|