C22H22N2O5 — CID 10862268
3-amino-2-[[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy](1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl]methyl]-3-oxopropanoic acid (PubChem CID 10862268) has the molecular formula C22H22N2O5 and a molecular weight of 400.38 g/mol. Its IUPAC name is 3-amino-2-[[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy](1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl]methyl]-3-oxopropanoic acid.
| Compound Name | 3-amino-2-[[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy](1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl]methyl]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 10862268 |
| Molecular Formula | C22H22N2O5 |
| Molecular Weight | 400.38 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 3-amino-2-[[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy](1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl]methyl]-3-oxopropanoic acid |
| SMILES | Cc1oc(-c2ccccc2)nc1CCO[13c]1[13cH][13cH][13c](CC(C(N)=O)C(=O)O)[13cH][13cH]1 |
| InChI | InChI=1S/C22H22N2O5/c1-14-19(24-21(29-14)16-5-3-2-4-6-16)11-12-28-17-9-7-15(8-10-17)13-18(20(23)25)22(26)27/h2-10,18H,11-13H2,1H3,(H2,23,25)(H,26,27)/i7+1,8+1,9+1,10+1,15+1,17+1 |
| InChIKey | ZXILSYIHBWBPKO-VVUYSBFWSA-N |
| XLogP | 3.00 |
| TPSA | 115.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.38 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|