C19H18ClNO2 — CID 11809594
4-[2-[4-(chloromethyl)phenoxy]ethyl]-5-methyl-2-phenyl-1,3-oxazole (PubChem CID 11809594) has the molecular formula C19H18ClNO2 and a molecular weight of 327.81 g/mol. Its IUPAC name is 4-[2-[4-(chloromethyl)phenoxy]ethyl]-5-methyl-2-phenyl-1,3-oxazole.
| Compound Name | 4-[2-[4-(chloromethyl)phenoxy]ethyl]-5-methyl-2-phenyl-1,3-oxazole |
|---|---|
| PubChem CID | 11809594 |
| Molecular Formula | C19H18ClNO2 |
| Molecular Weight | 327.81 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | 4-[2-[4-(chloromethyl)phenoxy]ethyl]-5-methyl-2-phenyl-1,3-oxazole |
| SMILES | Cc1oc(-c2ccccc2)nc1CCOc1ccc(CCl)cc1 |
| InChI | InChI=1S/C19H18ClNO2/c1-14-18(21-19(23-14)16-5-3-2-4-6-16)11-12-22-17-9-7-15(13-20)8-10-17/h2-10H,11-13H2,1H3 |
| InChIKey | BQQFVLUHPLPYSD-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.81 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|