C24H25NO6 — CID 6918417
dimethyl 2-[[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]methyl]propanedioate (PubChem CID 6918417) has the molecular formula C24H25NO6 and a molecular weight of 423.47 g/mol. Its IUPAC name is dimethyl 2-[[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]methyl]propanedioate.
| Compound Name | dimethyl 2-[[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]methyl]propanedioate |
|---|---|
| PubChem CID | 6918417 |
| Molecular Formula | C24H25NO6 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | dimethyl 2-[[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]methyl]propanedioate |
| SMILES | COC(=O)C(Cc1ccc(OCCc2nc(-c3ccccc3)oc2C)cc1)C(=O)OC |
| InChI | InChI=1S/C24H25NO6/c1-16-21(25-22(31-16)18-7-5-4-6-8-18)13-14-30-19-11-9-17(10-12-19)15-20(23(26)28-2)24(27)29-3/h4-12,20H,13-15H2,1-3H3 |
| InChIKey | OKDCTIYZEDHHSM-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 87.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|