C22H21BrClNO4 — CID 88600430
methyl 2-bromo-3-[4-[2-[2-(4-chlorophenyl)-5-methyl-1,3-oxazol-4-yl]ethoxy]phenyl]propanoate (PubChem CID 88600430) has the molecular formula C22H21BrClNO4 and a molecular weight of 478.77 g/mol. Its IUPAC name is methyl 2-bromo-3-[4-[2-[2-(4-chlorophenyl)-5-methyl-1,3-oxazol-4-yl]ethoxy]phenyl]propanoate.
| Compound Name | methyl 2-bromo-3-[4-[2-[2-(4-chlorophenyl)-5-methyl-1,3-oxazol-4-yl]ethoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 88600430 |
| Molecular Formula | C22H21BrClNO4 |
| Molecular Weight | 478.77 g/mol |
| Exact Mass | 477.03 |
| IUPAC Name | methyl 2-bromo-3-[4-[2-[2-(4-chlorophenyl)-5-methyl-1,3-oxazol-4-yl]ethoxy]phenyl]propanoate |
| SMILES | COC(=O)C(Br)Cc1ccc(OCCc2nc(-c3ccc(Cl)cc3)oc2C)cc1 |
| InChI | InChI=1S/C22H21BrClNO4/c1-14-20(25-21(29-14)16-5-7-17(24)8-6-16)11-12-28-18-9-3-15(4-10-18)13-19(23)22(26)27-2/h3-10,19H,11-13H2,1-2H3 |
| InChIKey | APTYSIJJEKFQKP-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.77 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|