C28H33NO6 — CID 22013863
dipropan-2-yl 2-[[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]methyl]propanedioate (PubChem CID 22013863) has the molecular formula C28H33NO6 and a molecular weight of 479.57 g/mol. Its IUPAC name is dipropan-2-yl 2-[[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]methyl]propanedioate.
| Compound Name | dipropan-2-yl 2-[[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]methyl]propanedioate |
|---|---|
| PubChem CID | 22013863 |
| Molecular Formula | C28H33NO6 |
| Molecular Weight | 479.57 g/mol |
| Exact Mass | 479.23 |
| IUPAC Name | dipropan-2-yl 2-[[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]methyl]propanedioate |
| SMILES | Cc1oc(-c2ccccc2)nc1CCOc1ccc(CC(C(=O)OC(C)C)C(=O)OC(C)C)cc1 |
| InChI | InChI=1S/C28H33NO6/c1-18(2)33-27(30)24(28(31)34-19(3)4)17-21-11-13-23(14-12-21)32-16-15-25-20(5)35-26(29-25)22-9-7-6-8-10-22/h6-14,18-19,24H,15-17H2,1-5H3 |
| InChIKey | VPTDSXNMNNOEOK-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 87.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.57 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|