C35H32N2O5 — CID 70229751
methyl 2-(2-benzoylanilino)-3-[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]propanoate (PubChem CID 70229751) has the molecular formula C35H32N2O5 and a molecular weight of 560.65 g/mol. Its IUPAC name is methyl 2-(2-benzoylanilino)-3-[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]propanoate.
| Compound Name | methyl 2-(2-benzoylanilino)-3-[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 70229751 |
| Molecular Formula | C35H32N2O5 |
| Molecular Weight | 560.65 g/mol |
| Exact Mass | 560.23 |
| IUPAC Name | methyl 2-(2-benzoylanilino)-3-[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]propanoate |
| SMILES | COC(=O)C(Cc1ccc(OCCc2nc(-c3ccccc3)oc2C)cc1)Nc1ccccc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C35H32N2O5/c1-24-30(37-34(42-24)27-13-7-4-8-14-27)21-22-41-28-19-17-25(18-20-28)23-32(35(39)40-2)36-31-16-10-9-15-29(31)33(38)26-11-5-3-6-12-26/h3-20,32,36H,21-23H2,1-2H3 |
| InChIKey | XRJTWUGNCHAXAJ-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.65 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|