C35H33N3O5 — CID 70227470
methyl 2-[2-(3-aminobenzoyl)anilino]-3-[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]propanoate (PubChem CID 70227470) has the molecular formula C35H33N3O5 and a molecular weight of 575.67 g/mol. Its IUPAC name is methyl 2-[2-(3-aminobenzoyl)anilino]-3-[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]propanoate.
| Compound Name | methyl 2-[2-(3-aminobenzoyl)anilino]-3-[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 70227470 |
| Molecular Formula | C35H33N3O5 |
| Molecular Weight | 575.67 g/mol |
| Exact Mass | 575.24 |
| IUPAC Name | methyl 2-[2-(3-aminobenzoyl)anilino]-3-[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]propanoate |
| SMILES | COC(=O)C(Cc1ccc(OCCc2nc(-c3ccccc3)oc2C)cc1)Nc1ccccc1C(=O)c1cccc(N)c1 |
| InChI | InChI=1S/C35H33N3O5/c1-23-30(38-34(43-23)25-9-4-3-5-10-25)19-20-42-28-17-15-24(16-18-28)21-32(35(40)41-2)37-31-14-7-6-13-29(31)33(39)26-11-8-12-27(36)22-26/h3-18,22,32,37H,19-21,36H2,1-2H3 |
| InChIKey | IWUKUYQJJCQZLJ-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 116.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.67 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|