C36H36N2O5 — CID 143761498
2-(2-benzoylanilino)-3-[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]propanoic acid;ethane (PubChem CID 143761498) has the molecular formula C36H36N2O5 and a molecular weight of 576.69 g/mol. Its IUPAC name is 2-(2-benzoylanilino)-3-[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]propanoic acid;ethane.
| Compound Name | 2-(2-benzoylanilino)-3-[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]propanoic acid;ethane |
|---|---|
| PubChem CID | 143761498 |
| Molecular Formula | C36H36N2O5 |
| Molecular Weight | 576.69 g/mol |
| Exact Mass | 576.26 |
| IUPAC Name | 2-(2-benzoylanilino)-3-[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]propanoic acid;ethane |
| SMILES | CC.Cc1oc(-c2ccccc2)nc1CCOc1ccc(CC(Nc2ccccc2C(=O)c2ccccc2)C(=O)O)cc1 |
| InChI | InChI=1S/C34H30N2O5.C2H6/c1-23-29(36-33(41-23)26-12-6-3-7-13-26)20-21-40-27-18-16-24(17-19-27)22-31(34(38)39)35-30-15-9-8-14-28(30)32(37)25-10-4-2-5-11-25;1-2/h2-19,31,35H,20-22H2,1H3,(H,38,39);1-2H3 |
| InChIKey | NJNVTXUFWTVEAO-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 101.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.69 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|