C36H32N2O5 — CID 143433779
4-(2-benzoylphenyl)-3-imino-2-[[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]methyl]butanoic acid (PubChem CID 143433779) has the molecular formula C36H32N2O5 and a molecular weight of 572.66 g/mol. Its IUPAC name is 4-(2-benzoylphenyl)-3-imino-2-[[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]methyl]butanoic acid.
| Compound Name | 4-(2-benzoylphenyl)-3-imino-2-[[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]methyl]butanoic acid |
|---|---|
| PubChem CID | 143433779 |
| Molecular Formula | C36H32N2O5 |
| Molecular Weight | 572.66 g/mol |
| Exact Mass | 572.23 |
| IUPAC Name | 4-(2-benzoylphenyl)-3-imino-2-[[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]methyl]butanoic acid |
| SMILES | [H]/N=C(/Cc1ccccc1C(=O)c1ccccc1)C(Cc1ccc(OCCc2nc(-c3ccccc3)oc2C)cc1)C(=O)O |
| InChI | InChI=1S/C36H32N2O5/c1-24-33(38-35(43-24)27-12-6-3-7-13-27)20-21-42-29-18-16-25(17-19-29)22-31(36(40)41)32(37)23-28-14-8-9-15-30(28)34(39)26-10-4-2-5-11-26/h2-19,31,37H,20-23H2,1H3,(H,40,41)/b37-32- |
| InChIKey | VYLZSWKCGHPVQY-FTTXPQLCSA-N |
| XLogP | 7.01 |
| TPSA | 113.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.66 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|