C25H25NO6 — CID 139706536
ethyl (E)-3-[2-acetyloxy-4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]prop-2-enoate (PubChem CID 139706536) has the molecular formula C25H25NO6 and a molecular weight of 435.48 g/mol. Its IUPAC name is ethyl (E)-3-[2-acetyloxy-4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[2-acetyloxy-4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 139706536 |
| Molecular Formula | C25H25NO6 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | ethyl (E)-3-[2-acetyloxy-4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1ccc(OCCc2nc(-c3ccccc3)oc2C)cc1OC(C)=O |
| InChI | InChI=1S/C25H25NO6/c1-4-29-24(28)13-11-19-10-12-21(16-23(19)32-18(3)27)30-15-14-22-17(2)31-25(26-22)20-8-6-5-7-9-20/h5-13,16H,4,14-15H2,1-3H3/b13-11+ |
| InChIKey | KOWOUNTUFDLTGI-ACCUITESSA-N |
| XLogP | 4.77 |
| TPSA | 87.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|