C24H21NO5 — CID 19694380
ethyl (E)-3-[6-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]-1-benzofuran-2-yl]prop-2-enoate (PubChem CID 19694380) has the molecular formula C24H21NO5 and a molecular weight of 403.43 g/mol. Its IUPAC name is ethyl (E)-3-[6-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]-1-benzofuran-2-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[6-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]-1-benzofuran-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 19694380 |
| Molecular Formula | C24H21NO5 |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | ethyl (E)-3-[6-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]-1-benzofuran-2-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1cc2ccc(OCc3nc(-c4ccccc4)oc3C)cc2o1 |
| InChI | InChI=1S/C24H21NO5/c1-3-27-23(26)12-11-20-13-18-9-10-19(14-22(18)30-20)28-15-21-16(2)29-24(25-21)17-7-5-4-6-8-17/h4-14H,3,15H2,1-2H3/b12-11+ |
| InChIKey | FWGVKDGFDKRAGB-VAWYXSNFSA-N |
| XLogP | 5.55 |
| TPSA | 74.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|