C22H17NO5 — CID 70283163
3-[6-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]-2-benzofuran-1-yl]prop-2-enoic acid (PubChem CID 70283163) has the molecular formula C22H17NO5 and a molecular weight of 375.38 g/mol. Its IUPAC name is 3-[6-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]-2-benzofuran-1-yl]prop-2-enoic acid.
| Compound Name | 3-[6-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]-2-benzofuran-1-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 70283163 |
| Molecular Formula | C22H17NO5 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | 3-[6-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]-2-benzofuran-1-yl]prop-2-enoic acid |
| SMILES | Cc1oc(-c2ccccc2)nc1COc1ccc2coc(C=CC(=O)O)c2c1 |
| InChI | InChI=1S/C22H17NO5/c1-14-19(23-22(28-14)15-5-3-2-4-6-15)13-26-17-8-7-16-12-27-20(18(16)11-17)9-10-21(24)25/h2-12H,13H2,1H3,(H,24,25) |
| InChIKey | IOUZEYCDQFVISN-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 85.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|