C23H16N2O5S — CID 67665157
4-methylidene-3-[6-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]-2-benzofuran-1-yl]-1,3-thiazolidine-2,5-dione (PubChem CID 67665157) has the molecular formula C23H16N2O5S and a molecular weight of 432.46 g/mol. Its IUPAC name is 4-methylidene-3-[6-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]-2-benzofuran-1-yl]-1,3-thiazolidine-2,5-dione.
| Compound Name | 4-methylidene-3-[6-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]-2-benzofuran-1-yl]-1,3-thiazolidine-2,5-dione |
|---|---|
| PubChem CID | 67665157 |
| Molecular Formula | C23H16N2O5S |
| Molecular Weight | 432.46 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | 4-methylidene-3-[6-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]-2-benzofuran-1-yl]-1,3-thiazolidine-2,5-dione |
| SMILES | C=C1C(=O)SC(=O)N1c1occ2ccc(OCc3nc(-c4ccccc4)oc3C)cc12 |
| InChI | InChI=1S/C23H16N2O5S/c1-13-22(26)31-23(27)25(13)21-18-10-17(9-8-16(18)11-29-21)28-12-19-14(2)30-20(24-19)15-6-4-3-5-7-15/h3-11H,1,12H2,2H3 |
| InChIKey | YPDPGVBONHKPJX-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 85.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.46 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|