C26H20N2O5 — CID 22344648
2-[[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methoxy]isoindole-1,3-dione (PubChem CID 22344648) has the molecular formula C26H20N2O5 and a molecular weight of 440.46 g/mol. Its IUPAC name is 2-[[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methoxy]isoindole-1,3-dione.
| Compound Name | 2-[[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 22344648 |
| Molecular Formula | C26H20N2O5 |
| Molecular Weight | 440.46 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | 2-[[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methoxy]isoindole-1,3-dione |
| SMILES | Cc1oc(-c2ccccc2)nc1COc1ccc(CON2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C26H20N2O5/c1-17-23(27-24(33-17)19-7-3-2-4-8-19)16-31-20-13-11-18(12-14-20)15-32-28-25(29)21-9-5-6-10-22(21)26(28)30/h2-14H,15-16H2,1H3 |
| InChIKey | BLIXXZXKTUTRQU-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 81.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.46 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|