C21H23NO5S — CID 87956133
3-[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]propyl methanesulfonate (PubChem CID 87956133) has the molecular formula C21H23NO5S and a molecular weight of 401.48 g/mol. Its IUPAC name is 3-[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]propyl methanesulfonate.
| Compound Name | 3-[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]propyl methanesulfonate |
|---|---|
| PubChem CID | 87956133 |
| Molecular Formula | C21H23NO5S |
| Molecular Weight | 401.48 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | 3-[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]propyl methanesulfonate |
| SMILES | Cc1oc(-c2ccccc2)nc1COc1ccc(CCCOS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C21H23NO5S/c1-16-20(22-21(27-16)18-8-4-3-5-9-18)15-25-19-12-10-17(11-13-19)7-6-14-26-28(2,23)24/h3-5,8-13H,6-7,14-15H2,1-2H3 |
| InChIKey | JKISWQZTURQLOJ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 78.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.48 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|