C26H32N2O7S — CID 87611767
[3-[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]-1-[(2-methylpropan-2-yl)oxycarbonylamino]propyl] methanesulfonate (PubChem CID 87611767) has the molecular formula C26H32N2O7S and a molecular weight of 516.62 g/mol. Its IUPAC name is [3-[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]-1-[(2-methylpropan-2-yl)oxycarbonylamino]propyl] methanesulfonate.
| Compound Name | [3-[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]-1-[(2-methylpropan-2-yl)oxycarbonylamino]propyl] methanesulfonate |
|---|---|
| PubChem CID | 87611767 |
| Molecular Formula | C26H32N2O7S |
| Molecular Weight | 516.62 g/mol |
| Exact Mass | 516.19 |
| IUPAC Name | [3-[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]-1-[(2-methylpropan-2-yl)oxycarbonylamino]propyl] methanesulfonate |
| SMILES | Cc1oc(-c2ccccc2)nc1COc1ccc(CCC(NC(=O)OC(C)(C)C)OS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C26H32N2O7S/c1-18-22(27-24(33-18)20-9-7-6-8-10-20)17-32-21-14-11-19(12-15-21)13-16-23(35-36(5,30)31)28-25(29)34-26(2,3)4/h6-12,14-15,23H,13,16-17H2,1-5H3,(H,28,29) |
| InChIKey | KUPSOTXCULKGTM-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 116.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.62 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|