C30H32N2O5 — CID 68883786
benzyl N-[1-ethoxy-3-[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]propyl]carbamate (PubChem CID 68883786) has the molecular formula C30H32N2O5 and a molecular weight of 500.60 g/mol. Its IUPAC name is benzyl N-[1-ethoxy-3-[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]propyl]carbamate.
| Compound Name | benzyl N-[1-ethoxy-3-[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]propyl]carbamate |
|---|---|
| PubChem CID | 68883786 |
| Molecular Formula | C30H32N2O5 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.23 |
| IUPAC Name | benzyl N-[1-ethoxy-3-[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]propyl]carbamate |
| SMILES | CCOC(CCc1ccc(OCc2nc(-c3ccccc3)oc2C)cc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C30H32N2O5/c1-3-34-28(32-30(33)36-20-24-10-6-4-7-11-24)19-16-23-14-17-26(18-15-23)35-21-27-22(2)37-29(31-27)25-12-8-5-9-13-25/h4-15,17-18,28H,3,16,19-21H2,1-2H3,(H,32,33) |
| InChIKey | KPAMWERUZLODPA-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 82.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|