C29H29NO6 — CID 68882836
2-[1-ethoxy-3-[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]propoxy]benzoic acid (PubChem CID 68882836) has the molecular formula C29H29NO6 and a molecular weight of 487.55 g/mol. Its IUPAC name is 2-[1-ethoxy-3-[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]propoxy]benzoic acid.
| Compound Name | 2-[1-ethoxy-3-[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]propoxy]benzoic acid |
|---|---|
| PubChem CID | 68882836 |
| Molecular Formula | C29H29NO6 |
| Molecular Weight | 487.55 g/mol |
| Exact Mass | 487.20 |
| IUPAC Name | 2-[1-ethoxy-3-[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]propoxy]benzoic acid |
| SMILES | CCOC(CCc1ccc(OCc2nc(-c3ccccc3)oc2C)cc1)Oc1ccccc1C(=O)O |
| InChI | InChI=1S/C29H29NO6/c1-3-33-27(36-26-12-8-7-11-24(26)29(31)32)18-15-21-13-16-23(17-14-21)34-19-25-20(2)35-28(30-25)22-9-5-4-6-10-22/h4-14,16-17,27H,3,15,18-19H2,1-2H3,(H,31,32) |
| InChIKey | UFGGLOHZTPLUDY-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 91.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.55 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|