C14H16BNO4S — CID 89174438
CID 89174438 (PubChem CID 89174438) has the molecular formula C14H16BNO4S and a molecular weight of 305.16 g/mol.
| Compound Name | CID 89174438 |
|---|---|
| PubChem CID | 89174438 |
| Molecular Formula | C14H16BNO4S |
| Molecular Weight | 305.16 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | — |
| SMILES | [B]Cc1ccc(-c2nc(CCOS(C)(=O)=O)c(C)o2)cc1 |
| InChI | InChI=1S/C14H16BNO4S/c1-10-13(7-8-19-21(2,17)18)16-14(20-10)12-5-3-11(9-15)4-6-12/h3-6H,7-9H2,1-2H3 |
| InChIKey | CLEQBYWYNSZTCP-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.16 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|