C19H18BrNO4S — CID 20823121
2-[2-(3-bromophenyl)-5-methyl-1,3-oxazol-4-yl]ethyl 4-methylbenzenesulfonate (PubChem CID 20823121) has the molecular formula C19H18BrNO4S and a molecular weight of 436.33 g/mol. Its IUPAC name is 2-[2-(3-bromophenyl)-5-methyl-1,3-oxazol-4-yl]ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[2-(3-bromophenyl)-5-methyl-1,3-oxazol-4-yl]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 20823121 |
| Molecular Formula | C19H18BrNO4S |
| Molecular Weight | 436.33 g/mol |
| Exact Mass | 435.01 |
| IUPAC Name | 2-[2-(3-bromophenyl)-5-methyl-1,3-oxazol-4-yl]ethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCc2nc(-c3cccc(Br)c3)oc2C)cc1 |
| InChI | InChI=1S/C19H18BrNO4S/c1-13-6-8-17(9-7-13)26(22,23)24-11-10-18-14(2)25-19(21-18)15-4-3-5-16(20)12-15/h3-9,12H,10-11H2,1-2H3 |
| InChIKey | KOADNYOMLAWJOE-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.33 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|