C23H27NO5S — CID 58979246
2-[2-(4-butoxyphenyl)-5-methyl-1,3-oxazol-4-yl]ethyl 4-methylbenzenesulfonate (PubChem CID 58979246) has the molecular formula C23H27NO5S and a molecular weight of 429.54 g/mol. Its IUPAC name is 2-[2-(4-butoxyphenyl)-5-methyl-1,3-oxazol-4-yl]ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[2-(4-butoxyphenyl)-5-methyl-1,3-oxazol-4-yl]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 58979246 |
| Molecular Formula | C23H27NO5S |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | 2-[2-(4-butoxyphenyl)-5-methyl-1,3-oxazol-4-yl]ethyl 4-methylbenzenesulfonate |
| SMILES | CCCCOc1ccc(-c2nc(CCOS(=O)(=O)c3ccc(C)cc3)c(C)o2)cc1 |
| InChI | InChI=1S/C23H27NO5S/c1-4-5-15-27-20-10-8-19(9-11-20)23-24-22(18(3)29-23)14-16-28-30(25,26)21-12-6-17(2)7-13-21/h6-13H,4-5,14-16H2,1-3H3 |
| InChIKey | ZAGWWSFCCVRJTF-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 78.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|