C14H17NO5S — CID 22507101
2-[2-(4-methoxyphenyl)-5-methyl-1,3-oxazol-4-yl]ethyl methanesulfonate (PubChem CID 22507101) has the molecular formula C14H17NO5S and a molecular weight of 311.36 g/mol. Its IUPAC name is 2-[2-(4-methoxyphenyl)-5-methyl-1,3-oxazol-4-yl]ethyl methanesulfonate.
| Compound Name | 2-[2-(4-methoxyphenyl)-5-methyl-1,3-oxazol-4-yl]ethyl methanesulfonate |
|---|---|
| PubChem CID | 22507101 |
| Molecular Formula | C14H17NO5S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | 2-[2-(4-methoxyphenyl)-5-methyl-1,3-oxazol-4-yl]ethyl methanesulfonate |
| SMILES | COc1ccc(-c2nc(CCOS(C)(=O)=O)c(C)o2)cc1 |
| InChI | InChI=1S/C14H17NO5S/c1-10-13(8-9-19-21(3,16)17)15-14(20-10)11-4-6-12(18-2)7-5-11/h4-7H,8-9H2,1-3H3 |
| InChIKey | UICCIDHSWMGIBM-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 78.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|