C13H15NO4S — CID 171571795
2-[5-methyl-2-(2,3,4,5,6-pentadeuteriophenyl)-1,3-oxazol-4-yl]ethyl methanesulfonate (PubChem CID 171571795) has the molecular formula C13H15NO4S and a molecular weight of 286.36 g/mol. Its IUPAC name is 2-[5-methyl-2-(2,3,4,5,6-pentadeuteriophenyl)-1,3-oxazol-4-yl]ethyl methanesulfonate.
| Compound Name | 2-[5-methyl-2-(2,3,4,5,6-pentadeuteriophenyl)-1,3-oxazol-4-yl]ethyl methanesulfonate |
|---|---|
| PubChem CID | 171571795 |
| Molecular Formula | C13H15NO4S |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 2-[5-methyl-2-(2,3,4,5,6-pentadeuteriophenyl)-1,3-oxazol-4-yl]ethyl methanesulfonate |
| SMILES | [2H]c1c([2H])c([2H])c(-c2nc(CCOS(C)(=O)=O)c(C)o2)c([2H])c1[2H] |
| InChI | InChI=1S/C13H15NO4S/c1-10-12(8-9-17-19(2,15)16)14-13(18-10)11-6-4-3-5-7-11/h3-7H,8-9H2,1-2H3/i3D,4D,5D,6D,7D |
| InChIKey | SIRKPSSXHXSLMR-DKFMXDSJSA-N |
| XLogP | 2.17 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|