C23H21NO4S2 — CID 86593520
2-[5-methyl-2-(4-thiophen-2-ylphenyl)-1,3-oxazol-4-yl]ethyl 2-methylbenzenesulfonate (PubChem CID 86593520) has the molecular formula C23H21NO4S2 and a molecular weight of 439.56 g/mol. Its IUPAC name is 2-[5-methyl-2-(4-thiophen-2-ylphenyl)-1,3-oxazol-4-yl]ethyl 2-methylbenzenesulfonate.
| Compound Name | 2-[5-methyl-2-(4-thiophen-2-ylphenyl)-1,3-oxazol-4-yl]ethyl 2-methylbenzenesulfonate |
|---|---|
| PubChem CID | 86593520 |
| Molecular Formula | C23H21NO4S2 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.09 |
| IUPAC Name | 2-[5-methyl-2-(4-thiophen-2-ylphenyl)-1,3-oxazol-4-yl]ethyl 2-methylbenzenesulfonate |
| SMILES | Cc1ccccc1S(=O)(=O)OCCc1nc(-c2ccc(-c3cccs3)cc2)oc1C |
| InChI | InChI=1S/C23H21NO4S2/c1-16-6-3-4-8-22(16)30(25,26)27-14-13-20-17(2)28-23(24-20)19-11-9-18(10-12-19)21-7-5-15-29-21/h3-12,15H,13-14H2,1-2H3 |
| InChIKey | PSZFFQLXGQNWLM-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|