C10H10BrNOS — CID 23352157
4-(2-bromoethyl)-5-methyl-2-thiophen-2-yl-1,3-oxazole (PubChem CID 23352157) has the molecular formula C10H10BrNOS and a molecular weight of 272.17 g/mol. Its IUPAC name is 4-(2-bromoethyl)-5-methyl-2-thiophen-2-yl-1,3-oxazole.
| Compound Name | 4-(2-bromoethyl)-5-methyl-2-thiophen-2-yl-1,3-oxazole |
|---|---|
| PubChem CID | 23352157 |
| Molecular Formula | C10H10BrNOS |
| Molecular Weight | 272.17 g/mol |
| Exact Mass | 270.97 |
| IUPAC Name | 4-(2-bromoethyl)-5-methyl-2-thiophen-2-yl-1,3-oxazole |
| SMILES | Cc1oc(-c2cccs2)nc1CCBr |
| InChI | InChI=1S/C10H10BrNOS/c1-7-8(4-5-11)12-10(13-7)9-3-2-6-14-9/h2-3,6H,4-5H2,1H3 |
| InChIKey | CGJZTQUJIYLOLX-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.17 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|