C9H12N2OS — CID 143800921
ethane;2-methyl-5-thiophen-2-yl-1,3,4-oxadiazole (PubChem CID 143800921) has the molecular formula C9H12N2OS and a molecular weight of 196.27 g/mol. Its IUPAC name is ethane;2-methyl-5-thiophen-2-yl-1,3,4-oxadiazole.
| Compound Name | ethane;2-methyl-5-thiophen-2-yl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 143800921 |
| Molecular Formula | C9H12N2OS |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | ethane;2-methyl-5-thiophen-2-yl-1,3,4-oxadiazole |
| SMILES | CC.Cc1nnc(-c2cccs2)o1 |
| InChI | InChI=1S/C7H6N2OS.C2H6/c1-5-8-9-7(10-5)6-3-2-4-11-6;1-2/h2-4H,1H3;1-2H3 |
| InChIKey | WZDRBIUBGXESFJ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |