C11H8N2OS — CID 158204466
2-(1-benzothiophen-2-yl)-5-methyl-1,3,4-oxadiazole (PubChem CID 158204466) has the molecular formula C11H8N2OS and a molecular weight of 216.26 g/mol. Its IUPAC name is 2-(1-benzothiophen-2-yl)-5-methyl-1,3,4-oxadiazole.
| Compound Name | 2-(1-benzothiophen-2-yl)-5-methyl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 158204466 |
| Molecular Formula | C11H8N2OS |
| Molecular Weight | 216.26 g/mol |
| Exact Mass | 216.04 |
| IUPAC Name | 2-(1-benzothiophen-2-yl)-5-methyl-1,3,4-oxadiazole |
| SMILES | Cc1nnc(-c2cc3ccccc3s2)o1 |
| InChI | InChI=1S/C11H8N2OS/c1-7-12-13-11(14-7)10-6-8-4-2-3-5-9(8)15-10/h2-6H,1H3 |
| InChIKey | GBIDDXKRZATUCR-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.26 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |