C11H8N2O2S — CID 136547874
2-(5-methyl-1,3,4-oxadiazol-2-yl)-1-benzothiophen-3-ol (PubChem CID 136547874) has the molecular formula C11H8N2O2S and a molecular weight of 232.26 g/mol. Its IUPAC name is 2-(5-methyl-1,3,4-oxadiazol-2-yl)-1-benzothiophen-3-ol.
| Compound Name | 2-(5-methyl-1,3,4-oxadiazol-2-yl)-1-benzothiophen-3-ol |
|---|---|
| PubChem CID | 136547874 |
| Molecular Formula | C11H8N2O2S |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.03 |
| IUPAC Name | 2-(5-methyl-1,3,4-oxadiazol-2-yl)-1-benzothiophen-3-ol |
| SMILES | Cc1nnc(-c2sc3ccccc3c2O)o1 |
| InChI | InChI=1S/C11H8N2O2S/c1-6-12-13-11(15-6)10-9(14)7-4-2-3-5-8(7)16-10/h2-5,14H,1H3 |
| InChIKey | FIQSQBYJNHCWKQ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'} |
|---|