C17H9ClN2O2S2 — CID 56969764
S-[5-(3-chloro-1-benzothiophen-2-yl)-1,3,4-oxadiazol-2-yl] benzenecarbothioate (PubChem CID 56969764) has the molecular formula C17H9ClN2O2S2 and a molecular weight of 372.86 g/mol. Its IUPAC name is S-[5-(3-chloro-1-benzothiophen-2-yl)-1,3,4-oxadiazol-2-yl] benzenecarbothioate.
| Compound Name | S-[5-(3-chloro-1-benzothiophen-2-yl)-1,3,4-oxadiazol-2-yl] benzenecarbothioate |
|---|---|
| PubChem CID | 56969764 |
| Molecular Formula | C17H9ClN2O2S2 |
| Molecular Weight | 372.86 g/mol |
| Exact Mass | 371.98 |
| IUPAC Name | S-[5-(3-chloro-1-benzothiophen-2-yl)-1,3,4-oxadiazol-2-yl] benzenecarbothioate |
| SMILES | O=C(Sc1nnc(-c2sc3ccccc3c2Cl)o1)c1ccccc1 |
| InChI | InChI=1S/C17H9ClN2O2S2/c18-13-11-8-4-5-9-12(11)23-14(13)15-19-20-17(22-15)24-16(21)10-6-2-1-3-7-10/h1-9H |
| InChIKey | KNGIOCJVCVPUQM-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.86 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|