C14H9N3O2S — CID 11403334
S-(5-pyridin-4-yl-1,3,4-oxadiazol-2-yl) benzenecarbothioate (PubChem CID 11403334) has the molecular formula C14H9N3O2S and a molecular weight of 283.31 g/mol. Its IUPAC name is S-(5-pyridin-4-yl-1,3,4-oxadiazol-2-yl) benzenecarbothioate.
| Compound Name | S-(5-pyridin-4-yl-1,3,4-oxadiazol-2-yl) benzenecarbothioate |
|---|---|
| PubChem CID | 11403334 |
| Molecular Formula | C14H9N3O2S |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | S-(5-pyridin-4-yl-1,3,4-oxadiazol-2-yl) benzenecarbothioate |
| SMILES | O=C(Sc1nnc(-c2ccncc2)o1)c1ccccc1 |
| InChI | InChI=1S/C14H9N3O2S/c18-13(11-4-2-1-3-5-11)20-14-17-16-12(19-14)10-6-8-15-9-7-10/h1-9H |
| InChIKey | CBDOCFBGBWUPQK-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 68.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|