C21H14N6O4S — CID 5045768
[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl] N-anilino-2-oxo-2-pyridin-4-ylethanimidothioate (PubChem CID 5045768) has the molecular formula C21H14N6O4S and a molecular weight of 446.45 g/mol. Its IUPAC name is [5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl] N-anilino-2-oxo-2-pyridin-4-ylethanimidothioate.
| Compound Name | [5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl] N-anilino-2-oxo-2-pyridin-4-ylethanimidothioate |
|---|---|
| PubChem CID | 5045768 |
| Molecular Formula | C21H14N6O4S |
| Molecular Weight | 446.45 g/mol |
| Exact Mass | 446.08 |
| IUPAC Name | [5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl] N-anilino-2-oxo-2-pyridin-4-ylethanimidothioate |
| SMILES | O=C(C(=NNc1ccccc1)Sc1nnc(-c2ccc([N+](=O)[O-])cc2)o1)c1ccncc1 |
| InChI | InChI=1S/C21H14N6O4S/c28-18(14-10-12-22-13-11-14)20(25-23-16-4-2-1-3-5-16)32-21-26-24-19(31-21)15-6-8-17(9-7-15)27(29)30/h1-13,23H |
| InChIKey | OXYQRZPVTFOGPB-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 136.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.45 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|