C22H16BrN5O4S — CID 21177535
[5-(4-bromophenyl)-1,3,4-oxadiazol-2-yl] (1E)-2-hydroxy-N-(4-nitroanilino)-2-phenylethanimidothioate (PubChem CID 21177535) has the molecular formula C22H16BrN5O4S and a molecular weight of 526.37 g/mol. Its IUPAC name is [5-(4-bromophenyl)-1,3,4-oxadiazol-2-yl] (1E)-2-hydroxy-N-(4-nitroanilino)-2-phenylethanimidothioate.
| Compound Name | [5-(4-bromophenyl)-1,3,4-oxadiazol-2-yl] (1E)-2-hydroxy-N-(4-nitroanilino)-2-phenylethanimidothioate |
|---|---|
| PubChem CID | 21177535 |
| Molecular Formula | C22H16BrN5O4S |
| Molecular Weight | 526.37 g/mol |
| Exact Mass | 525.01 |
| IUPAC Name | [5-(4-bromophenyl)-1,3,4-oxadiazol-2-yl] (1E)-2-hydroxy-N-(4-nitroanilino)-2-phenylethanimidothioate |
| SMILES | O=[N+]([O-])c1ccc(N/N=C(/Sc2nnc(-c3ccc(Br)cc3)o2)C(O)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H16BrN5O4S/c23-16-8-6-15(7-9-16)20-25-27-22(32-20)33-21(19(29)14-4-2-1-3-5-14)26-24-17-10-12-18(13-11-17)28(30)31/h1-13,19,24,29H/b26-21+ |
| InChIKey | KFLJRNTZOSHOOJ-YYADALCUSA-N |
| XLogP | 5.66 |
| TPSA | 126.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.37 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|