C17H12BrN5O5S — CID 71596649
N'-[2-[[5-(4-bromophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]-3-nitrobenzohydrazide (PubChem CID 71596649) has the molecular formula C17H12BrN5O5S and a molecular weight of 478.28 g/mol. Its IUPAC name is N'-[2-[[5-(4-bromophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]-3-nitrobenzohydrazide.
| Compound Name | N'-[2-[[5-(4-bromophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]-3-nitrobenzohydrazide |
|---|---|
| PubChem CID | 71596649 |
| Molecular Formula | C17H12BrN5O5S |
| Molecular Weight | 478.28 g/mol |
| Exact Mass | 476.97 |
| IUPAC Name | N'-[2-[[5-(4-bromophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]-3-nitrobenzohydrazide |
| SMILES | O=C(CSc1nnc(-c2ccc(Br)cc2)o1)NNC(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H12BrN5O5S/c18-12-6-4-10(5-7-12)16-21-22-17(28-16)29-9-14(24)19-20-15(25)11-2-1-3-13(8-11)23(26)27/h1-8H,9H2,(H,19,24)(H,20,25) |
| InChIKey | TWKRFKZVUGBMST-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 140.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.28 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|