C17H13ClN4O3S — CID 7907046
N'-[2-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]benzohydrazide (PubChem CID 7907046) has the molecular formula C17H13ClN4O3S and a molecular weight of 388.84 g/mol. Its IUPAC name is N'-[2-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]benzohydrazide.
| Compound Name | N'-[2-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]benzohydrazide |
|---|---|
| PubChem CID | 7907046 |
| Molecular Formula | C17H13ClN4O3S |
| Molecular Weight | 388.84 g/mol |
| Exact Mass | 388.04 |
| IUPAC Name | N'-[2-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]benzohydrazide |
| SMILES | O=C(CSc1nnc(-c2ccc(Cl)cc2)o1)NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C17H13ClN4O3S/c18-13-8-6-12(7-9-13)16-21-22-17(25-16)26-10-14(23)19-20-15(24)11-4-2-1-3-5-11/h1-9H,10H2,(H,19,23)(H,20,24) |
| InChIKey | GKSRWURFVHPERS-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.84 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|